CAS 5424-05-5: quinoxalin-2-amine

Description:Quinoxalin-2-amine, with the CAS number 5424-05-5, is an organic compound characterized by its bicyclic structure, which consists of a quinoxaline ring with an amino group (-NH2) at the 2-position. This compound is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols. Quinoxalin-2-amine exhibits basic properties due to the presence of the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. Additionally, quinoxalin-2-amine can serve as a building block in the synthesis of more complex organic molecules and pharmaceuticals. Its reactivity and functionalization make it a valuable compound in research and development within the fields of organic and medicinal chemistry. Safety precautions should be observed when handling this compound, as with many organic amines, due to potential toxicity and irritant properties.

Formula:C₈H₇N₃

InChI:InChI=1/C8H7N3/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-5H,(H2,9,11)

Synonyms:
2-Aminoquinoxaline
2-Quinoxalinamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Aminoquinoxaline REF: IN-DA00DBQBCAS: 5424-05-5	97%	30.00 €~295.00 €	Thu 02 Oct 25
Quinoxalin-2-amine REF: 54-OR938970CAS: 5424-05-5	97%	47.00 €~377.00 €	Fri 03 Oct 25
Quinoxalin-2-amine REF: 10-F233245CAS: 5424-05-5	95.0%	To inquire	Tue 14 Oct 25
2-Aminoquinoxaline REF: 3D-FA17846CAS: 5424-05-5	Min. 95%	- - -	Discontinued product