CAS 5424-27-1
:(4-aminobenzyl)phosphonic acid
Description:
(4-Aminobenzyl)phosphonic acid, with the CAS number 5424-27-1, is an organophosphorus compound characterized by the presence of both an amino group and a phosphonic acid functional group. This compound typically appears as a white to off-white solid and is soluble in water due to the polar nature of the phosphonic acid moiety. Its structure features a benzene ring substituted with an amino group at the para position relative to the phosphonic acid group, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the phosphonic acid group is known for its ability to form stable complexes with metal ions and its role in biological systems. Additionally, (4-aminobenzyl)phosphonic acid may exhibit biological activity, making it of interest for research in medicinal chemistry and biochemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H10NO3P
InChI:InChI=1/C7H10NO3P/c8-7-3-1-6(2-4-7)5-12(9,10)11/h1-4H,5,8H2,(H2,9,10,11)
SMILES:c1cc(ccc1CP(=O)(O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Aminobenzyl)phosphonic Acid
CAS:Formula:C7H10NO3PPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:187.134-Aminobenzylphosphonic acid
CAS:Formula:C7H10NO3PPurity:98%Color and Shape:SolidMolecular weight:187.1330(4-Aminobenzyl)Phosphonic Acid
CAS:<p>(4-Aminobenzyl)Phosphonic Acid</p>Purity:98%Molecular weight:187.13g/mol4-Aminobenzylphosphonic Acid
CAS:<p>4-Aminobenzylphosphonic acid, an inhibitor of alkaline phosphatase (Ki= 1.1 mM for the bovine intestine enzyme), is utilized in affinity chromatography for alkaline phosphatase purification and in the electrochemical modification of glassy carbon electrodes.</p>Formula:C7H10NO3PColor and Shape:SolidMolecular weight:187.13




