CAS 54241-01-9
:8-chloro-11-(4-methylpiperazin-1-yl)-10H-dibenzo[b,e][1,4]diazepine hydrochloride (1:1)
Description:
8-Chloro-11-(4-methylpiperazin-1-yl)-10H-dibenzo[b,e][1,4]diazepine hydrochloride is a chemical compound characterized by its complex structure, which includes a dibenzo[1,4]diazepine core. This compound features a chlorine atom at the 8-position and a 4-methylpiperazine moiety at the 11-position, contributing to its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The presence of the piperazine ring suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of anxiolytic or antipsychotic agents. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and formulation. Safety and handling precautions are essential due to its potential biological activity, and it should be handled in accordance with relevant safety guidelines. Overall, this compound represents a significant area of research in the field of pharmaceuticals, particularly in the context of neuroactive drugs.
Formula:C18H20Cl2N4
InChI:InChI=1/C18H19ClN4.ClH/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18;/h2-7,12,21H,8-11H2,1H3;1H
SMILES:CN1CCN(CC1)C1=c2ccccc2=Nc2ccc(cc2N1)Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Clozapine HCl
CAS:<p>Clozapine HCl, an atypical antipsychotic, binds CNS receptors, targets 5-HT2A/2C, has weaker D2 antagonism. Risk: Agranulocytosis.</p>Formula:C18H20Cl2N4Color and Shape:SolidMolecular weight:363.29
