CymitQuimica logo

CAS 54248-02-1

:

(2S)-2-methyl-5-oxohexanoic acid

Description:
(2S)-2-methyl-5-oxohexanoic acid, with the CAS number 54248-02-1, is an organic compound characterized by its carboxylic acid functional group and a ketone group, which contribute to its reactivity and solubility in polar solvents. This compound features a six-carbon chain with a methyl group at the second carbon and a keto group at the fifth carbon, indicating its structural complexity. The presence of the stereocenter at the second carbon (2S configuration) implies that it exists as one specific enantiomer, which can exhibit distinct biological activity compared to its mirror image. Typically, compounds like this can participate in various chemical reactions, including esterification and decarboxylation, and may serve as intermediates in synthetic organic chemistry or in metabolic pathways. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, (2S)-2-methyl-5-oxohexanoic acid is of interest in both academic research and potential industrial applications.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c1-5(7(9)10)3-4-6(2)8/h5H,3-4H2,1-2H3,(H,9,10)/t5-/m0/s1
SMILES:C[C@@H](CCC(=O)C)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.