CAS 54254-38-5

1-[(2-nitrophenyl)sulfonyl]-1H-pyrrole-2-carbaldehyde

Description:

1-[(2-Nitrophenyl)sulfonyl]-1H-pyrrole-2-carbaldehyde is an organic compound characterized by its unique structural features, which include a pyrrole ring, a nitrophenyl group, and a sulfonyl moiety. The presence of the nitro group introduces significant electron-withdrawing properties, influencing the compound's reactivity and polarity. The sulfonyl group enhances the compound's solubility in polar solvents and can participate in various chemical reactions, such as nucleophilic substitutions. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its aldehyde functional group is reactive, allowing for further derivatization, such as condensation reactions. The compound's properties, including melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of the nitro group, which can be toxic and potentially explosive under certain conditions.

Formula: C₁₁H₈N₂O₅S

InChI: InChI=1/C11H8N2O5S/c14-8-9-4-3-7-12(9)19(17,18)11-6-2-1-5-10(11)13(15)16/h1-8H

SMILES: c1ccc(c(c1)N(=O)=O)S(=O)(=O)n1cccc1C=O

1-[(2-nitrophenyl)sulphonyl]-1H-pyrrole-2-carboxaldehyde

CAS: 54254-38-5

1-[(2-nitrophenyl)sulphonyl]-1H-pyrrole-2-carboxaldehyde

Purity: ≥95%

Molecular weight: 280.26g/mol

Ref: 54-OR29276