CAS 54258-41-2
:1,10-phenanthrolin-5-amine
Description:
1,10-Phenanthrolin-5-amine, with the CAS number 54258-41-2, is an organic compound characterized by its phenanthroline structure, which consists of three fused aromatic rings. This compound features an amino group (-NH2) at the 5-position of the phenanthroline framework, which can influence its chemical reactivity and solubility. It is typically a crystalline solid and may exhibit properties such as fluorescence, making it useful in various applications, including coordination chemistry and as a ligand in metal complexes. The presence of the amino group allows for potential interactions with other chemical species, enhancing its utility in biological and analytical chemistry. Additionally, 1,10-phenanthrolin-5-amine may participate in hydrogen bonding and can act as a chelating agent, forming stable complexes with transition metals. Its unique structural features and functional groups contribute to its significance in research and industrial applications, particularly in the fields of materials science and medicinal chemistry.
Formula:C12H9N3
InChI:InChI=1/C12H9N3/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,13H2
SMILES:c1cc2cc(c3cccnc3c2nc1)N
Synonyms:- (1,10)Phenanthrolin-5-Ylamine
- 5-Amino-1,10-Phenanthroline
- Amino-1,10-phenanthroline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Amino-1,10-phenanthroline
CAS:Formula:C12H9N3Purity:>98.0%(GC)Color and Shape:White to Amber powder to crystalMolecular weight:195.231,10-Phenanthrolin-5-amine
CAS:Formula:C12H9N3Purity:95%Color and Shape:SolidMolecular weight:195.22001,10-Phenanthrolin-5-amine
CAS:Formula:C12H9N3Purity:95%Color and Shape:Solid, Powder or Crystalline Powder or SolidMolecular weight:195.225(1,10)Phenanthrolin-5-ylamine
CAS:<p>(1,10)Phenanthrolin-5-ylamine is a sample preparation reagent that has been used in the production of polymers with redox potentials below 0.2 V. This compound is also an antimicrobial agent that has shown to be effective against bacteria and fungi. The detection sensitivity of (1,10)phenanthrolin-5-ylamine is high, making it suitable for use in human serum samples. It can be protonated by a base such as sodium hydroxide or ammonia to form its cationic form, which can then react with nucleophiles such as thiols and amines to produce an alkylating agent. It has been used in the synthesis of l1210 murine leukemia cells and has been observed to have photophysical properties that are sensitive to neutral pH levels. <br>(1,10)Phenanthrolin-5-ylamine can be used for process optimization</p>Formula:C12H9N3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:195.22 g/mol1,10-Phenanthrolin-5-amine
CAS:<p>Applications 1,10-Phenanthrolin-5-amine is a potential fluorescent label for DNA detection. 1,10-Phenanthrolin-5-amine is used as a mediator for glucose oxidase for development of biosensors and biofuel cells<br>References Qin, P.-Z. et al.: Analyst, 135, 2144 (2010); Oztekin, Y. et al.: Biosens. Bioelectron., 26, 267 (2010);<br></p>Formula:C12H9N3Color and Shape:NeatMolecular weight:195.22





