CAS 5426-11-9

2-(2-methylpropanoyl)-1H-indene-1,3(2H)-dione

Description:

2-(2-methylpropanoyl)-1H-indene-1,3(2H)-dione, also known by its CAS number 5426-11-9, is an organic compound characterized by its indene structure fused with a diketone functionality. This compound features a 2-methylpropanoyl group attached to the indene ring, which contributes to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the diketone moiety allows for potential reactivity in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as a building block in organic synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₃H₁₂O₃

InChI: InChI=1/C13H12O3/c1-7(2)11(14)10-12(15)8-5-3-4-6-9(8)13(10)16/h3-7,10H,1-2H3

SMILES: CC(C)C(=O)C1C(=O)c2ccccc2C1=O

2-(2-methylpropanoyl)indane-1,3-dione

CAS: 5426-11-9

2-(2-methylpropanoyl)indane-1,3-dione is a nonsteroidal anti-inflammatory drug that inhibits the biosynthesis of prostaglandins from arachidonic acid by inhibiting cyclooxygenase. It has been shown to have biological activity in rats with carrageenan-induced inflammation and to be active against the inflammatory response in the rat paw induced by an injection of carrageenan. 2-(2-Methylpropanoyl)indane-1,3-dione also inhibits the metabolism of arachidonic acid, which may lead to a decrease in the production of prostaglandins.

Purity: Min. 95%

Ref: 3D-FM169792