CAS 5426-59-5

6-bromo-2-methylquinazolin-4(1H)-one

Description:

6-Bromo-2-methylquinazolin-4(1H)-one is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused benzene and pyrimidine ring system. The presence of a bromine atom at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the solvent conditions. It is often utilized in medicinal chemistry and pharmaceutical research due to its potential biological activities, including antimicrobial and anticancer properties. The compound's reactivity can be influenced by the functional groups present, making it a versatile intermediate in organic synthesis. Additionally, its molecular structure allows for various substitution reactions, which can be exploited to develop derivatives with enhanced pharmacological profiles. Safety data should be consulted for handling, as with many brominated compounds, it may pose environmental and health risks.

Formula: C₉H₇BrN₂O

InChI: InChI=1/C9H7BrN2O/c1-5-11-8-3-2-6(10)4-7(8)9(13)12-5/h2-4H,1H3,(H,11,12,13)

SMILES: Cc1nc2ccc(cc2c(n1)O)Br

Synonyms:

• 4(3H)-quinazolinone, 6-bromo-2-methyl-
• 4-Quinazolinol, 6-Bromo-2-Methyl-
• 6-Bromo-2-methylquinazolin-4(3H)-one
• 6-Bromo-2-Methylquinazolin-4-Ol

6-Bromo-2-methylquinazolin-4(3H)-one

CAS: 5426-59-5

Formula: C₉H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.0687

Ref: IN-DA0038NT

6-Bromo-2-methylquinazolin-4(3H)-one

CAS: 5426-59-5

6-Bromo-2-methylquinazolin-4(3H)-one

Purity: 96%

Molecular weight: 239.07g/mol

Ref: 54-OR1011988

6-Bromo-2-methylquinazolin-4(3H)-one

CAS: 5426-59-5

Formula: C₉H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.072

Ref: 10-F076113