CAS 5426-73-3

N-phenylphenylalaninamide

Description:

N-phenylphenylalaninamide, with the CAS number 5426-73-3, is an organic compound characterized by its amide functional group and the presence of both phenyl and phenylalanine moieties. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and stability under standard conditions. Its structure suggests potential interactions through hydrogen bonding due to the amide group, which can influence its reactivity and biological activity. N-phenylphenylalaninamide may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as the phenylalanine derivative can mimic amino acid behavior in biological systems. Additionally, the presence of multiple aromatic rings may contribute to its hydrophobic characteristics, affecting its distribution and interaction with biological membranes. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and biological applications.

Formula: C₁₅H₁₆N₂O

InChI: InChI=1/C15H16N2O/c16-14(11-12-7-3-1-4-8-12)15(18)17-13-9-5-2-6-10-13/h1-10,14H,11,16H2,(H,17,18)

SMILES: c1ccc(cc1)CC(C(=Nc1ccccc1)O)N

Synonyms:

• benzenepropanamide, alpha-amino-N-phenyl-

2-Amino-N,3-diphenylpropanamide

CAS: 5426-73-3

Formula: C₁₅H₁₆N₂O

Color and Shape: Solid

Molecular weight: 240.3003

Ref: IN-DA00I9P1

(S)-2-AMINO-3,N-DIPHENYLPROPANAMIDE

CAS: 5426-73-3

Formula: C₁₅H₁₆N₂O

Purity: 97.0%

Color and Shape: No data available.

Molecular weight: 240.306

Ref: 10-F514020

2-Amino-N,3-diphenylpropanamide

CAS: 5426-73-3

2-Amino-N,3-diphenylpropanamide is a chiral compound that can be synthesized from 2-propanol and amide. It has two moieties, which are the amide and the protonated amino group. The amide moiety is a chiral center because it has four different substituents. The experimental thermodynamic experiments show that the enantiomer with the R configuration has higher energy than the one with the S configuration. This is due to its high steric hindrance and its electron donating property.

Formula: C₁₅H₁₆N₂O

Purity: Min. 95%

Molecular weight: 240.3 g/mol

Ref: 3D-FAA42673