CAS 54260-72-9
:9,10-dimethoxy-13-methyl-5,6-dihydro[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ium chloride
Description:
9,10-Dimethoxy-13-methyl-5,6-dihydro[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ium chloride, with the CAS number 54260-72-9, is a complex organic compound characterized by its unique bicyclic structure that incorporates both isoquinoline and dioxole moieties. This compound typically exhibits a quaternary ammonium structure due to the presence of a positively charged nitrogen atom, which contributes to its solubility in polar solvents. The dimethoxy groups enhance its electron-donating properties, potentially influencing its reactivity and interaction with biological systems. The methyl group at the 13-position may affect its steric properties and overall stability. As a chloride salt, it is likely to be soluble in water and other polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Its structural complexity suggests potential bioactivity, although specific pharmacological properties would require further investigation. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in drug development and material science.
Formula:C21H20ClNO4
InChI:InChI=1/C21H20NO4.ClH/c1-12-14-4-5-17(23-2)21(24-3)16(14)10-22-7-6-13-8-18-19(26-11-25-18)9-15(13)20(12)22;/h4-5,8-10H,6-7,11H2,1-3H3;1H/q+1;/p-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5,6-Dihydro-2,3-(methylenedioxy)-9,10-dimethoxy-13-methyldibenzo[a,g]quinolizinium
CAS:Formula:C21H20ClNO4Purity:95%Molecular weight:385.840813-Methylberberine chloride
CAS:13-Methylberberine chloride shows anti-adipogenic effect on 3T3-L1 adipocytes, it has potential as an anti-obesity drugFormula:C21H20ClNO4Purity:98.88% - 99.83%Color and Shape:SolidMolecular weight:385.84Ref: TM-TN1189
1mg64.00€5mg120.00€1mL*10mM (DMSO)130.00€10mg160.00€25mg259.00€50mg389.00€100mg563.00€13-Methylberberine chloride
CAS:13-Methylberberine chloride is a synthetic derivative of berberine, an isoquinoline alkaloid, which is typically extracted from various plants such as Mahonia aquifolium, Berberis vulgaris, and Coptis chinensis. This compound is modified by adding a methyl group, which enhances its biological activity and overall pharmacokinetic properties. The mode of action of 13-Methylberberine chloride involves a diverse range of biochemical pathways. It is known to influence cellular signaling, modulate enzyme activities, and affect gene expression, making it a versatile compound for in vitro and in vivo studies.
Formula:C21H20ClNO4Purity:Min. 95%Molecular weight:385.84 g/mol





