CymitQuimica logo

CAS 54261-98-2

:

a-D-Glucopyranoside, b-D-fructofuranosyl O-a-D-galactopyranosyl-(1®6)-O-a-D-galactopyranosyl-(1®6)-, hydrate (9CI)

Description:
The chemical substance known as "α-D-Glucopyranoside, β-D-fructofuranosyl O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-, hydrate" with CAS number 54261-98-2 is a complex carbohydrate, specifically a glycoside. It is composed of multiple sugar units, including glucose, fructose, and galactose, linked through glycosidic bonds. This compound is typically found in various natural sources and may play a role in biological processes, such as energy storage and cellular signaling. Its structure suggests it has multiple hydroxyl groups, which contribute to its solubility in water and its potential as a sweetener or food additive. The presence of multiple sugar moieties also indicates that it may exhibit prebiotic properties, promoting the growth of beneficial gut bacteria. Additionally, as a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. Overall, this compound is of interest in both food chemistry and biochemistry due to its functional properties and potential health benefits.
Formula:C24H42O21・xH2O
InChI:InChI=1S/C24H42O21/c25-1-6-10(28)14(32)17(35)21(41-6)39-3-8-11(29)15(33)18(36)22(42-8)40-4-9-12(30)16(34)19(37)23(43-9)45-24(5-27)20(38)13(31)7(2-26)44-24/h6-23,25-38H,1-5H2
InChI key:UQZIYBXSHAGNOE-UHFFFAOYSA-N
SMILES:C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC3C(C(C(C(O3)OC4(C(C(C(O4)CO)O)O)CO)O)O)O)O)O)O)O)O)O)O
Synonyms:
  • Stachyose
Found 10 products.