CAS 54261-98-2
:a-D-Glucopyranoside, b-D-fructofuranosyl O-a-D-galactopyranosyl-(1®6)-O-a-D-galactopyranosyl-(1®6)-, hydrate (9CI)
Description:
The chemical substance known as "α-D-Glucopyranoside, β-D-fructofuranosyl O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-, hydrate" with CAS number 54261-98-2 is a complex carbohydrate, specifically a glycoside. It is composed of multiple sugar units, including glucose, fructose, and galactose, linked through glycosidic bonds. This compound is typically found in various natural sources and may play a role in biological processes, such as energy storage and cellular signaling. Its structure suggests it has multiple hydroxyl groups, which contribute to its solubility in water and its potential as a sweetener or food additive. The presence of multiple sugar moieties also indicates that it may exhibit prebiotic properties, promoting the growth of beneficial gut bacteria. Additionally, as a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. Overall, this compound is of interest in both food chemistry and biochemistry due to its functional properties and potential health benefits.
Formula:C24H42O21・xH2O
InChI:InChI=1S/C24H42O21/c25-1-6-10(28)14(32)17(35)21(41-6)39-3-8-11(29)15(33)18(36)22(42-8)40-4-9-12(30)16(34)19(37)23(43-9)45-24(5-27)20(38)13(31)7(2-26)44-24/h6-23,25-38H,1-5H2
InChI key:UQZIYBXSHAGNOE-UHFFFAOYSA-N
SMILES:C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC3C(C(C(C(O3)OC4(C(C(C(O4)CO)O)O)CO)O)O)O)O)O)O)O)O)O)O
Synonyms:- Stachyose
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Stachyose Hydrate
CAS:Formula:C24H42O21·xH2OPurity:>98.0%(HPLC)Color and Shape:White powder to crystalMolecular weight:666.58Stachyose hydrate, 98%
CAS:Formula:C24H42O21·xH2OPurity:(HPLC) ≥ 98.0% (dry basis)Color and Shape:White to off-white powderMolecular weight:666.58Stachyose hydrate
CAS:Formula:C24H42O21·xH2OPurity:(HPLC) ≥ 90.0%Color and Shape:White powderMolecular weight:666.58 (anhydrous)Stachyose Hydrate
CAS:Controlled ProductStability Hygroscopic
Applications Stachyose Hydrate is a low molecular weight carbohydrate that was separated through an EM Gel OR-PVA column.
References Belue, G.P., McGinnis, G.D.: J. Chormatogr., 97, 25 (1974)Formula:C24H42O21·H2OColor and Shape:NeatMolecular weight:684.59Stachyose hydrate
CAS:Stachyose hydrate highly promotes proliferation of lactic acid bacteria (LAB) by inducing LAB to produce more α-galactosidase to hydrolyze stachyose.Formula:C24H42O21·xH2OPurity:98% - 99.35%Color and Shape:SolidMolecular weight:666.6Stachyose hydrate - 80%
CAS:Non-reducing storage and transport sugar in woody plants; used as a sweetenerFormula:C24H42O21•(H2O)xPurity:Min. 80 Area-%Color and Shape:PowderMolecular weight:684.59 g/molRef: 3D-OS01892
Discontinued productStachyose hydrate - 98%
CAS:Non-reducing storage and transport sugar in woody plants; used as a sweetener
Formula:C24H42O21·xH2OPurity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:666.58 g/molRef: 3D-OS31795
Discontinued product







