CAS 5428-08-0

2-amino-4-cyclohexylbutanoic acid

Description:

2-Amino-4-cyclohexylbutanoic acid, with the CAS number 5428-08-0, is an amino acid derivative characterized by its cyclohexyl group attached to the butanoic acid backbone. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids, contributing to its potential as a building block in peptide synthesis. The cyclohexyl substituent introduces a hydrophobic character, influencing its solubility and interaction with biological systems. The presence of both polar and non-polar regions allows for diverse applications, particularly in pharmaceuticals and biochemistry. Its structural configuration may also affect its stereochemistry, which is crucial for biological activity. Additionally, 2-amino-4-cyclohexylbutanoic acid may exhibit properties such as being a zwitterion at physiological pH, impacting its behavior in solution and interactions with other biomolecules. Overall, this compound's unique structure and functional groups make it of interest in various chemical and biological research fields.

Formula: C₁₀H₁₉NO₂

InChI: InChI=1/C10H19NO2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h8-9H,1-7,11H2,(H,12,13)

SMILES: C1CCC(CC1)CCC(C(=O)O)N

2-Amino-4-cyclohexylbutanoic Acid

Controlled Product

CAS: 5428-08-0

Formula: C₁₀H₁₉NO₂

Color and Shape: Neat

Molecular weight: 185.263

Ref: TR-A595906