CAS 5428-09-1

2-(prop-2-en-1-yl)-1H-isoindole-1,3(2H)-dione

Description:

2-(Prop-2-en-1-yl)-1H-isoindole-1,3(2H)-dione, also known by its CAS number 5428-09-1, is an organic compound characterized by its isoindole structure, which features a fused bicyclic system. This compound contains a vinyl group (prop-2-en-1-yl) attached to the isoindole moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the dione functional groups indicates that it has two carbonyl (C=O) groups, which can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of dyes or polymers. Additionally, the compound's reactivity can be influenced by the presence of substituents and the overall electronic environment, making it a subject of interest in synthetic organic chemistry.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c1-2-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h2-6H,1,7H2

SMILES: C=CCN1C(=O)c2ccccc2C1=O

Synonyms:

• 1H-isoindole-1,3(2H)-dione, 2-(2-propen-1-yl)-
• 2-Allyl-1H-isoindole-1,3(2H)-dione

N-Allylphthalimide

CAS: 5428-09-1

Formula: C₁₁H₉NO₂

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 187.20

Ref: 3B-A2696

N-Allylphthalimide

CAS: 5428-09-1

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA00DFA3

2-Allylisoindoline-1,3-dione

CAS: 5428-09-1

2-Allylisoindoline-1,3-dione

Purity: 98%

Molecular weight: 187.19g/mol

Ref: 54-OR931715

2-Allylisoindoline-1,3-dione

CAS: 5428-09-1

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.198

Ref: 10-F233120