CAS 54280-71-6
:3,5-Diethyl 1,4-dihydro-2,6-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)-3,5-pyridinedicarboxylate
Description:
3,5-Diethyl 1,4-dihydro-2,6-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)-3,5-pyridinedicarboxylate, with the CAS number 54280-71-6, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of diethyl and dimethyl groups contributes to its hydrophobic properties, while the pentafluorophenyl substituent enhances its electron-withdrawing characteristics, potentially affecting its reactivity and solubility in organic solvents. This compound may exhibit interesting biological activities due to its unique molecular framework, making it a candidate for research in medicinal chemistry. Its dihydropyridine structure suggests potential applications in the development of pharmaceuticals, particularly in the context of calcium channel modulation. Additionally, the fluorinated aromatic ring may impart stability and lipophilicity, influencing its pharmacokinetic properties. Overall, this compound's distinctive features make it a subject of interest for further investigation in various chemical and biological contexts.
Formula:C19H18F5NO4
InChI:InChI=1S/C19H18F5NO4/c1-5-28-18(26)9-7(3)25-8(4)10(19(27)29-6-2)11(9)12-13(20)15(22)17(24)16(23)14(12)21/h11,25H,5-6H2,1-4H3
InChI key:InChIKey=QABNLWXKUCMDBP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OCC)=O)=C(C)NC1C)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:- 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)-, 3,5-diethyl ester
- 3,5-Bis(ethoxycarbonyl)-1,4-dihydro-2,6-dimethyl-4-(pentafluorophenyl)pyridine
- Nemadipine A
- 3,5-Diethyl 1,4-dihydro-2,6-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)-3,5-pyridinedicarboxylate
- 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(pentafluorophenyl)-, diethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Diethyl 2,6-Dimethyl-4-(Pentafluorophenyl)-1,4-Dihydro-3,5-Pyridinedicarboxylate
CAS:<p>Diethyl 2,6-dimethyl-4-(pentafluorophenyl)-1,4-dihydro-3,5-pyridinedicarboxylate (DMPP) is a chemical compound that induces apoptotic cell death. It binds to the ryanodine receptor and causes an increase in intracellular calcium levels. This leads to the activation of caspases, which are proteins that induce apoptosis. DMPP has been shown to induce apoptosis in animals and Caenorhabditis elegans models systems. In addition, DMPP has been found to inhibit cancer growth by binding to response element binding protein (RBP). DMPP binds RBP with high affinity and specificity and inhibits its DNA binding activity.</p>Formula:C19H18F5NO4Purity:Min. 95%Molecular weight:419.34 g/molNemadipine-A
CAS:Nemadipine A blocks L-type Ca2+ channels, alters C. elegans morphology, boosts TRAIL's cancer kill rate, and lowers Survivin in A549 cells.Formula:C19H18F5NO4Color and Shape:SolidMolecular weight:419.34

