CAS 54283-65-7

Magnesium salz der (2,4-dimethoxyphenyl)-3-crotonsaeure [German]

Description:

The chemical substance known as "Magnesium salz der (2,4-dimethoxyphenyl)-3-crotonsaeure," with the CAS number 54283-65-7, is a magnesium salt of a specific organic acid derived from crotonic acid and substituted with a 2,4-dimethoxyphenyl group. This compound typically exhibits characteristics associated with magnesium salts, such as solubility in polar solvents and potential applications in organic synthesis or as a reagent in various chemical reactions. The presence of the dimethoxyphenyl group suggests that the compound may possess unique electronic and steric properties, which could influence its reactivity and interactions with other molecules. Additionally, magnesium salts are often used in biological systems and may have implications in medicinal chemistry. The specific structural features of this compound, including its functional groups and stereochemistry, would further dictate its chemical behavior and potential applications in research or industry. Overall, this compound represents an interesting intersection of organometallic chemistry and organic synthesis.

Formula: C₂₄H₂₆MgO₈

InChI: InChI=1S/2C12H14O4.Mg/c2*1-8(6-12(13)14)10-5-4-9(15-2)7-11(10)16-3;/h2*4-7H,1-3H3,(H,13,14);/q;;+2/p-2/b2*8-6-;

InChI key: NRMWCJKNPLZLMY-HIGYRTBYSA-L

SMILES: C/C(=C/C(=O)[O-])/C1=C(C=C(C=C1)OC)OC.C/C(=C/C(=O)[O-])/C1=C(C=C(C=C1)OC)OC.[Mg+2]

Synonyms:

• Bis[(Z)-3-(2,4-Dimethoxyphenyl)-2-Butenoic Acid]Magnesium Salt