CAS 5429-00-5

2-chloro-4-(piperidin-1-yl)pyrimidine

Description:

2-Chloro-4-(piperidin-1-yl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a piperidine moiety. The presence of the chlorine atom at the 2-position and the piperidine group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits basic properties due to the nitrogen atoms in the piperidine ring, which can participate in hydrogen bonding and other interactions. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and antitumor properties. Its structure allows for various chemical modifications, making it a versatile intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as with many halogenated compounds, it may pose health risks if not managed properly.

Formula: C₉H₁₂ClN₃

InChI: InChI=1/C9H12ClN3/c10-9-11-5-4-8(12-9)13-6-2-1-3-7-13/h4-5H,1-3,6-7H2

SMILES: C1CCN(CC1)c1ccnc(Cl)n1

Synonyms:

• 2-Chloro-4-piperidinopyrimidine
• Pyrimidine, 2-Chloro-4-(1-Piperidinyl)-

2-CHLORO-4-PIPERIDIN-1-YL-PYRIMIDINE

CAS: 5429-00-5

Formula: C₉H₁₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.6647

Ref: IN-DA00D8WC

2-Chloro-4-piperidinopyrimidine

CAS: 5429-00-5

2-Chloro-4-piperidinopyrimidine

Purity: 95%

Molecular weight: 197.66g/mol

Ref: 54-OR909497

2-Chloro-4-piperidin-1-ylpyrimidine

CAS: 5429-00-5

Formula: C₉H₁₂ClN₃

Purity: 97.0%

Molecular weight: 197.67

Ref: 10-F067418

2-Chloro-4-piperidinopyrimidine

Controlled Product

CAS: 5429-00-5

Applications 2-Chloro-4-piperidinopyrimidine

Formula: C₉H₁₂ClN₃

Color and Shape: Neat

Molecular weight: 197.67

Ref: TR-C350900