CAS 5429-01-6

4-methylquinolin-6-ol

Description:

4-Methylquinolin-6-ol, with the CAS number 5429-01-6, is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure that includes a benzene ring and a pyridine ring. This compound features a hydroxyl group (-OH) at the 6-position and a methyl group (-CH3) at the 4-position of the quinoline ring system, which contributes to its unique chemical properties. It is typically a yellow to brown solid and is soluble in organic solvents, with limited solubility in water. The presence of the hydroxyl group imparts mild acidity, allowing it to participate in hydrogen bonding and potentially act as a ligand in coordination chemistry. 4-Methylquinolin-6-ol has been studied for its biological activities, including antimicrobial and antioxidant properties, making it of interest in pharmaceutical research. Additionally, its derivatives may exhibit varied reactivity, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₀H₉NO

InChI: InChI=1/C10H9NO/c1-7-4-5-11-10-3-2-8(12)6-9(7)10/h2-6,12H,1H3

SMILES: Cc1ccnc2ccc(cc12)O

4-Methylquinolin-6-ol

CAS: 5429-01-6

4-Methylquinolin-6-ol

Purity: 98%

Ref: 54-OR1040896

4-Methylquinolin-6-ol

CAS: 5429-01-6

Purity: 98%

Molecular weight: 159.1880035

Ref: 10-F604509

4-Methylquinolin-6-ol

Controlled Product

CAS: 5429-01-6

Formula: C₁₀H₉NO

Color and Shape: Neat

Molecular weight: 159.185

Ref: TR-M256551