CAS 5430-78-4
:1,4-Piperazinediacetic acid
Description:
1,4-Piperazinediacetic acid, with the CAS number 5430-78-4, is an organic compound characterized by its piperazine backbone with two carboxylic acid functional groups. This compound is a white crystalline solid that is soluble in water and exhibits a relatively high melting point. It is often used in various applications, including as a chelating agent in coordination chemistry, where it can form stable complexes with metal ions. The presence of the piperazine ring contributes to its ability to interact with biological systems, making it of interest in pharmaceutical research. Additionally, 1,4-piperazinediacetic acid can serve as a building block in the synthesis of more complex molecules. Its chemical structure allows for potential modifications, which can enhance its properties for specific applications. Overall, this compound is notable for its versatility in both industrial and research settings, particularly in the fields of medicinal chemistry and materials science.
Formula:C8H14N2O4
InChI:InChI=1S/C8H14N2O4/c11-7(12)5-9-1-2-10(4-3-9)6-8(13)14/h1-6H2,(H,11,12)(H,13,14)
InChI key:InChIKey=JERMFLFKXHHROS-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCN(CC(O)=O)CC1
Synonyms:- 1,4-Piperazinediacetic acid
- 2,2'-Piperazine-1,4-Diyldiacetic Acid
- 2,2′-(Piperazine-1,4-diyl)diacetic acid
- 2-[4-(Carboxymethyl)piperazin-1-yl]acetic acid
- Nsc 13414
- Piperazine-1,4-diacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Bis(Methylcarboxy)piperazine
CAS:Controlled ProductFormula:C8H14N2O4Color and Shape:NeatMolecular weight:202.208
