CAS 54300-65-1
:2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Description:
2-(3,4-Dihydroxyphenyl)-5,6-dihydroxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside, with the CAS number 54300-65-1, is a flavonoid glycoside characterized by its complex structure that includes a chromone backbone and a glucose moiety. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties and biological activities. The presence of the beta-D-glucopyranoside unit enhances its solubility in water and may influence its pharmacokinetics and bioavailability. Flavonoids, including this compound, are known for their roles in plant pigmentation and their health benefits, including anti-inflammatory and anti-cancer effects. The specific arrangement of hydroxyl groups and the glycosidic bond can affect the compound's reactivity and interaction with biological systems. Overall, this substance is of interest in both natural product chemistry and pharmacology, particularly for its potential therapeutic applications.
Formula:C21H20O12
InChI:InChI=1/C21H20O12/c22-6-14-17(27)19(29)20(30)21(33-14)32-13-5-12-15(18(28)16(13)26)10(25)4-11(31-12)7-1-2-8(23)9(24)3-7/h1-5,14,17,19-24,26-30H,6H2/t14-,17-,19+,20-,21-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Hydroxyluteolin 7-glucoside
CAS:6-Hydroxyluteolin 7-glucosidePurity:≥95%Molecular weight:464.38g/mol6-Hydroxyluteolin 7-glucoside
CAS:6-Hydroxyluteolin 7-glucoside is derived from Tanacetum parthenium and T. vulgare showing anti-inflammatory effects.Formula:C21H20O12Purity:99.84%Color and Shape:SolidMolecular weight:464.38Ref: TM-TN1315
1mg130.00€5mg314.00€1mL*10mM (DMSO)358.00€10mg505.00€25mg800.00€50mg1,071.00€100mg1,431.00€Hydroxyl luteolin-o-glucoside
CAS:Hydroxyl luteolin-o-glucoside is a bioactive flavonoid glycoside, which is primarily derived from various plant sources, including herbs and vegetables. This compound is characterized by its luteolin core structure linked to glucose molecules. Its mode of action involves exerting strong antioxidant effects through the scavenging of free radicals and modulation of oxidative stress pathways within biological systems, making it a compound of interest in the study of cellular protection mechanisms.Formula:C21H20O12Purity:Min. 95%Molecular weight:464.4 g/mol




