CAS 5431-35-6
:P-(4-Chlorophenyl)phosphonic acid
Description:
P-(4-Chlorophenyl)phosphonic acid, with the CAS number 5431-35-6, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group attached to a para-chlorophenyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. It exhibits acidic properties due to the phosphonic acid group, allowing it to participate in acid-base reactions. The presence of the chlorophenyl group can influence its reactivity and biological activity, making it of interest in fields such as agrochemicals and pharmaceuticals. Additionally, P-(4-Chlorophenyl)phosphonic acid may serve as a building block in organic synthesis or as a reagent in the preparation of other phosphorus-containing compounds. Safety data indicates that, like many organophosphorus compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and properties make it a valuable compound in various chemical research and industrial applications.
Formula:C6H6ClO3P
InChI:InChI=1S/C6H6ClO3P/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10)
InChI key:InChIKey=MVCIBABYNNIPFI-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)C1=CC=C(Cl)C=C1
Synonyms:- (p-Chlorophenyl)phosphonic acid
- 4-Chlorophenylphosphonic acid
- NSC 13560
- P-(4-Chlorophenyl)phosphonic acid
- Phosphonic Acid, (4-Chlorophenyl)-
- Phosphonic acid, (p-chlorophenyl)-
- Phosphonic acid, P-(4-chlorophenyl)-
- p-Chlorobenzenephosphonic acid
- (4-Chlorophenyl)phosphonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
