CAS 5432-13-3

2-methyl-1-[(2E)-3-(2-nitrophenyl)prop-2-en-1-yl]piperidine

Description:

2-Methyl-1-[(2E)-3-(2-nitrophenyl)prop-2-en-1-yl]piperidine is an organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The presence of a 2-methyl group and a 2-nitrophenyl substituent on a prop-2-en-1-yl chain indicates that this compound has both aliphatic and aromatic characteristics. The nitrophenyl group contributes to the compound's potential reactivity and polarity, while the piperidine structure provides basicity due to the nitrogen atom. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features suggest it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the presence of the nitro group may influence its electronic properties, potentially affecting its interaction with biological targets. Overall, 2-methyl-1-[(2E)-3-(2-nitrophenyl)prop-2-en-1-yl]piperidine is a complex molecule with diverse chemical properties and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₅H₂₀N₂O₂

InChI: InChI=1/C15H20N2O2/c1-13-7-4-5-11-16(13)12-6-9-14-8-2-3-10-15(14)17(18)19/h2-3,6,8-10,13H,4-5,7,11-12H2,1H3/b9-6+

N1,N2-Bis[2-(diethylamino)ethyl]ethanediamide

CAS: 5432-13-3

Please enquire for more information about N1,N2-Bis[2-(diethylamino)ethyl]ethanediamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₃₀N₄O₂

Purity: Min. 95%

Molecular weight: 286.41 g/mol

Ref: 3D-FAA43213