CAS 5432-33-7

5-O-carbomethoxy-1,2-O-isopropylidene-*D-xylofura

Description:

5-O-carbomethoxy-1,2-O-isopropylidene-D-xylofuranose, with the CAS number 5432-33-7, is a carbohydrate derivative characterized by its furanose structure, which is a five-membered ring containing oxygen. This compound features a carbomethoxy group at the 5-position and is protected by isopropylidene groups at the 1 and 2 positions, which are commonly used to stabilize the molecule during synthetic processes. The presence of these protective groups enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, particularly in glycosylation and other carbohydrate chemistry applications. Its stereochemistry, denoted by the "D" in its name, indicates that it is derived from D-xylose, a naturally occurring sugar. The compound's reactivity is influenced by the functional groups present, allowing for further modifications and derivatizations in synthetic organic chemistry. Overall, this compound serves as an important intermediate in the synthesis of more complex carbohydrate structures and derivatives.

Formula: C₁₀H₁₆O₇

InChI: InChI=1/C10H16O7/c1-10(2)16-7-6(11)5(15-8(7)17-10)4-14-9(12)13-3/h5-8,11H,4H2,1-3H3

SMILES: CC1(C)OC2C(C(COC(=O)OC)OC2O1)O

Synonyms:

• 5-O-(methoxycarbonyl)-1,2-O-(1-methylethylidene)pentofuranose

5-O-Carbomethoxy-1,2-O-isopropylidene-D-xylofuranose

CAS: 5432-33-7

Formula: C₁₀H₁₆O₇

Molecular weight: 248.23

Ref: 7W-GC9219

5-O-Carbomethoxy-1,2-O-isopropylidene-a-D-xylofuranose

CAS: 5432-33-7

5-O-Carbomethoxy-1,2-O-isopropylidene-a-D-xylofuranose is a compound that is found in the venom of the Chinese scorpion Buthus martensii. This compound has been shown to induce death in mice.

Formula: C₁₀H₁₆O₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 248.23 g/mol

Ref: 3D-MC05405