CAS 54328-09-5

Protopseudohypericin

Description:

Protopseudohypericin is a chemical compound belonging to the class of naphthodianthrones, which are primarily found in the plant Hypericum perforatum, commonly known as St. John's Wort. This substance is characterized by its complex polycyclic structure, which contributes to its biological activity. Protopseudohypericin exhibits antioxidant properties and has been studied for its potential therapeutic effects, particularly in the context of mood disorders and other health conditions. It is known to interact with various biological pathways, including those related to neurotransmitter regulation. The compound is typically extracted from plant sources and may be present in various forms, including as a pigment in the plant's tissues. Its CAS number, 54328-09-5, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. As with many phytochemicals, further research is ongoing to fully elucidate its mechanisms of action and potential applications in medicine.

Formula: C₃₀H₁₈O₉

InChI: InChI=1S/C30H18O9/c1-9-2-11-19(13(32)3-9)29(38)25-17(36)6-15(34)23-24-16(35)7-18(37)26-28(24)22(21(11)27(23)25)12-4-10(8-31)5-14(33)20(12)30(26)39/h2-7,31-37H,8H2,1H3

InChI key: InChIKey=QFAPJWSQKUFHAP-UHFFFAOYSA-N

SMILES: OC=1C=2C3=C(C4=C5C2C(O)=CC(O)=C5C(=O)C=6C4=CC(C)=CC6O)C=7C(C(=O)C3=C(O)C1)=C(O)C=C(CO)C7

Synonyms:

• 1,3,4,6,8,15-Hexahydroxy-10-(Hydroxymethyl)-13-Methyldibenzo[A,O]Perylene-7,16-Dione
• Dibenzo[a,o]perylene-7,16-dione, 1,3,4,6,8,15-hexahydroxy-10-(hydroxymethyl)-13-methyl-
• Protopseudohypericin

Protopseudohypericin

CAS: 54328-09-5

Protopseudohypericin is a natural product

Formula: C₃₀H₁₈O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 522.46

Ref: TM-TN2109

Protopseudohypericin

CAS: 54328-09-5

Formula: C₃₀H₁₈O₉

Purity: 95%~99%

Molecular weight: 522.465

Ref: BP-BP1159

Protopseudohypericin

CAS: 54328-09-5

Protopseudohypericin is a naturally occurring compound, which is a derivative of the plant genus Hypericum. This compound, extracted from Hypericum species, acts primarily as a photodynamic agent. Upon exposure to light, particularly in the ultraviolet and visible spectrum, protopseudohypericin undergoes photoactivation, leading to the generation of reactive oxygen species.

Formula: C₃₀H₁₈O₉

Purity: Min. 95%

Molecular weight: 522.5 g/mol

Ref: 3D-ECA32809