CAS 54329-48-5
:(S)-2-Benzyl-1,2,3,4-Tetrahydro-Isoquinoline-3-Carboxylic Acid
Description:
(S)-2-Benzyl-1,2,3,4-Tetrahydro-Isoquinoline-3-Carboxylic Acid is a chiral compound belonging to the isoquinoline family, characterized by its bicyclic structure that includes a tetrahydroisoquinoline moiety. This compound features a benzyl group at the 2-position and a carboxylic acid functional group at the 3-position, contributing to its potential biological activity. The presence of the chiral center indicates that it can exist in two enantiomeric forms, with the (S)-configuration being of particular interest in medicinal chemistry due to its specific interactions with biological targets. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions or as intermediates in organic synthesis. As with many isoquinoline derivatives, it may also possess interesting pharmacological properties, including analgesic or anti-inflammatory effects, although specific biological activities would require further investigation.
Formula:C17H17NO2
InChI:InChI=1/C17H17NO2/c19-17(20)16-10-14-8-4-5-9-15(14)12-18(16)11-13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,19,20)
Synonyms:- 2-Benzyl-1,2,3,4-Tetrahydroisoquinoline-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
CAS:Formula:C17H17NO2Color and Shape:SolidMolecular weight:267.32242-Benzyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid
CAS:2-Benzyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is a versatile building block that can be used in the synthesis of fine chemicals and pharmaceuticals. It is used as a precursor to other compounds such as 2-benzylisoquinoline and 2-(2'-benzyloxy)benzoic acid. It is also used as a reagent for various research purposes.Formula:C17H17NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:267.32 g/mol2-Benzyl-1,2,3,4-Tetrahydroisoquinoline-3-Carboxylic Acid
CAS:Controlled ProductApplications 2-Benzyl-1,2,3,4-Tetrahydroisoquinoline-3-Carboxylic Acid (cas# 54329-48-5) is a useful research chemical.
Formula:C17H17NO2Color and Shape:NeatMolecular weight:267.32



