CAS 5433-44-3
:4,4'-(1E)-triaz-1-ene-1,3-diyldibenzenesulfonamide
Description:
4,4'-(1E)-triaz-1-ene-1,3-diyldibenzenesulfonamide, with the CAS number 5433-44-3, is a chemical compound characterized by its sulfonamide functional group and a triazene structure. This compound typically exhibits properties associated with both sulfonamides and azoles, including potential antimicrobial and antitumor activities. The presence of the triazene moiety suggests that it may participate in various chemical reactions, including azo coupling and hydrazone formation. Its sulfonamide group contributes to its solubility in polar solvents and may influence its biological activity. The compound's molecular structure includes two benzene rings connected by a triazene linkage, which can affect its electronic properties and reactivity. Additionally, the compound may exhibit stability under standard conditions but could be sensitive to light or heat, depending on its specific substituents. Overall, 4,4'-(1E)-triaz-1-ene-1,3-diyldibenzenesulfonamide represents a class of compounds with diverse applications in medicinal chemistry and materials science.
Formula:C12H13N5O4S2
InChI:InChI=1/C12H13N5O4S2/c13-22(18,19)11-5-1-9(2-6-11)15-17-16-10-3-7-12(8-4-10)23(14,20)21/h1-8H,(H,15,16)(H2,13,18,19)(H2,14,20,21)
SMILES:c1cc(ccc1N=NNc1ccc(cc1)S(=O)(=O)N)S(=O)(=O)N
Synonyms:- 4,4'-Triaz-1-ene-1,3-diyldibenzenesulfonamide
- Benzenesulfonamide, 4,4'-(1-Triazene-1,3-Diyl)Bis-
- Benzenesulfonamide, 4,4'-(1-triazene-1,3-diyl)bis- (9CI)
- Sulfadimethoxine Impurity 7
- 1,3-di(4-sulfamoylphenyl)triazene
- Sulfadimethoxine Impurity 1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
