CAS 54333-78-7
:4,6-diamino-2,3-dihydroxycyclohexyl 2,6-diamino-2,4,6-trideoxyhexopyranoside
Description:
4,6-Diamino-2,3-dihydroxycyclohexyl 2,6-diamino-2,4,6-trideoxyhexopyranoside, with the CAS number 54333-78-7, is a complex organic compound characterized by its multiple amino and hydroxy functional groups. This structure suggests it may exhibit significant solubility in polar solvents due to the presence of hydroxyl groups, which can form hydrogen bonds. The compound's cyclohexyl and hexopyranoside moieties indicate a potential for biological activity, possibly interacting with biological systems or serving as a precursor in synthetic pathways. The presence of amino groups may also suggest potential for reactivity in various chemical reactions, such as acylation or alkylation. Additionally, the stereochemistry of the compound could influence its biological interactions and pharmacological properties. Overall, this compound's unique structural features may make it of interest in medicinal chemistry, particularly in the development of therapeutics or as a biochemical probe. Further studies would be necessary to elucidate its specific properties and potential applications.
Formula:C12H26N4O5
InChI:InChI=1/C12H26N4O5/c13-3-4-1-7(17)8(16)12(20-4)21-11-6(15)2-5(14)9(18)10(11)19/h4-12,17-19H,1-3,13-16H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Seldomycin factor 2
CAS:Seldomycin factor 2 (XK 88-2) is an aminoglycoside antibiotic with broad-spectrum antibacterial activity.Formula:C12H26N4O5Color and Shape:SolidMolecular weight:306.359
