CAS 54340-59-9
:Ethyl 10-chloro-3-(ethoxymethyl)-2,3,6,9-tetrahydro-9-oxo-1,4-dioxino[2,3-g]quinoline-8-carboxylate
Description:
Ethyl 10-chloro-3-(ethoxymethyl)-2,3,6,9-tetrahydro-9-oxo-1,4-dioxino[2,3-g]quinoline-8-carboxylate, with CAS number 54340-59-9, is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a quinoline core fused with a dioxin moiety. This compound typically exhibits a range of chemical properties, including solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carboxylate and chloro substituents. Its ethyl ester functionality suggests it may undergo hydrolysis under acidic or basic conditions, leading to the corresponding carboxylic acid. The presence of the chloro group may also impart unique reactivity, making it a candidate for further chemical modifications. Additionally, compounds of this type may exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological properties and applications would require further investigation through empirical studies.
Formula:C17H18ClNO6
InChI:InChI=1S/C17H18ClNO6/c1-3-22-7-9-8-24-16-12(25-9)5-11-13(14(16)18)15(20)10(6-19-11)17(21)23-4-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,19,20)
InChI key:InChIKey=AZOPNLGKZVSIIQ-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC3=C1OCC(COCC)O3)NC=C(C(OCC)=O)C2=O
Synonyms:- 1,4-Dioxino[2,3-g]quinoline-8-carboxylic acid, 10-chloro-3-(ethoxymethyl)-2,3,6,9-tetrahydro-9-oxo-, ethyl ester
- Ethyl 10-Chloro-3-(Ethoxymethyl)-9-Oxo-2,3,6,9-Tetrahydro[1,4]Dioxino[2,3-G]Quinoline-8-Carboxylate
- Ethyl 10-chloro-3-(ethoxymethyl)-2,3,6,9-tetrahydro-9-oxo-1,4-dioxino[2,3-g]quinoline-8-carboxylate
- Ethyl 10-chloro-3-(ethoxymethyl)-2,3,6,9-tetrahydro-9-oxo-p-dioxino[2,3-g]quinoline-8-carboxylate
- NSC 287475
- Quincarbate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Quincarbate
CAS:Quincarbate is a medicinal compound that acts as an inhibitor of kinase enzymes. Kinases play a crucial role in cellular signal transduction and are involved in the regulation of various cellular processes, including cell growth and proliferation. Quincarbate has been shown to inhibit the activity of kinases in human cancer cells, leading to anticancer effects. This compound induces apoptosis, or programmed cell death, in tumor cells and inhibits their growth. Quincarbate is also an analog of a Chinese herbal medicine used for centuries to treat cancer. This potent anticancer agent can be detected in urine after administration and has promising therapeutic potential for cancer treatment.
Formula:C17H18ClNO6Purity:Min. 95%Molecular weight:367.8 g/mol

