CymitQuimica logo

CAS 54340-63-5

:

1-[(4-Chlorophenoxy)methyl]-1,2,3,4-tetrahydro-6,7-isoquinolinediol

Description:
1-[(4-Chlorophenoxy)methyl]-1,2,3,4-tetrahydro-6,7-isoquinolinediol, identified by its CAS number 54340-63-5, is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core. This compound features a chlorophenoxy group, which contributes to its potential biological activity. The presence of hydroxyl groups in the isoquinoline structure suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. The chlorophenoxy moiety may enhance lipophilicity, influencing the compound's interaction with biological membranes. This substance is of interest in medicinal chemistry due to its potential pharmacological applications, including neuroactive properties. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its effects on various biological systems. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies and literature review.
Formula:C16H16ClNO3
InChI:InChI=1S/C16H16ClNO3/c17-11-1-3-12(4-2-11)21-9-14-13-8-16(20)15(19)7-10(13)5-6-18-14/h1-4,7-8,14,18-20H,5-6,9H2
InChI key:InChIKey=GVALVWDQPXGPCE-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(Cl)C=C1)C2C=3C(=CC(O)=C(O)C3)CCN2
Synonyms:
  • 6,7-Isoquinolinediol, 1-[(4-chlorophenoxy)methyl]-1,2,3,4-tetrahydro-
  • 1-[(4-Chlorophenoxy)methyl]-1,2,3,4-tetrahydro-6,7-isoquinolinediol
  • Clofeverine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.