CAS 54346-27-9

pyrazolo[1,5-a][1,3,5]triazin-4(6H)-one

Description:

Pyrazolo[1,5-a][1,3,5]triazin-4(6H)-one is a heterocyclic compound characterized by a fused ring system that includes both pyrazole and triazine moieties. This compound typically exhibits a planar structure due to the conjugated system of double bonds, which can contribute to its stability and reactivity. It is known for its potential biological activities, including antimicrobial and antitumor properties, making it of interest in medicinal chemistry. The presence of the triazine ring can enhance its ability to interact with biological targets, while the pyrazole component may influence its solubility and pharmacokinetic properties. Additionally, this compound may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the presence of reactive functional groups. Its CAS number, 54346-27-9, allows for easy identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and agrochemicals. Overall, pyrazolo[1,5-a][1,3,5]triazin-4(6H)-one represents a versatile scaffold for further exploration in chemical and biological applications.

Formula: C₅H₄N₄O

InChI: InChI=1/C5H4N4O/c10-5-7-3-6-4-1-2-8-9(4)5/h1-3,8H

SMILES: c1c[nH]n2c1ncnc2=O

Pyrazolo[1,5-a][1,3,5]triazin-4(3H)-one

CAS: 54346-27-9

Formula: C₅H₄N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.1115

Ref: IN-DA0038NN

1H,4H-Pyrazolo[1,5-a][1,3,5]triazin-4-one

CAS: 54346-27-9

1H,4H-Pyrazolo[1,5-a][1,3,5]triazin-4-one

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.11g/mol

Ref: 54-OR924884

3H,4H-pyrazolo[1,5-a][1,3,5]triazin-4-one

CAS: 54346-27-9

Purity: 95%

Molecular weight: 136.114

Ref: 10-F959993

Pyrazolo[1,5-a][1,3,5]triazin-4(3H)-one

CAS: 54346-27-9

Formula: C₅H₄N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.114

Ref: 10-F238053

Pyrazolo[1,5-a][1,3,5]triazin-4(3H)-one

CAS: 54346-27-9

Pyrazolo[1,5-a][1,3,5]triazin-4(3H)-one is an organic chemical with a molecular formula of C6H4N2O2. It is a pyrazol derivative that is used in the synthesis of pesticides and pharmaceuticals. Pyrazolo[1,5-a][1,3,5]triazin-4(3H)-one has been shown to have pesticidal and antitumor properties. It also has angiotensin-converting enzyme inhibitory activity.

Formula: C₅H₄N₄O

Purity: Min. 95%

Molecular weight: 136.11 g/mol

Ref: 3D-ECA34627