CAS 54346-87-1
:5-Methoxy-2-benzothiazolamine
Description:
5-Methoxy-2-benzothiazolamine is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a methoxy group (-OCH3) at the 5-position of the benzothiazole, contributing to its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group (-NH2) in its structure suggests potential for hydrogen bonding, influencing its interactions in biological systems and chemical reactions. This compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activities. Additionally, its unique structure allows for the exploration of its derivatives, which could lead to the development of new pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C8H8N2OS
InChI:InChI=1S/C8H8N2OS/c1-11-5-2-3-7-6(4-5)10-8(9)12-7/h2-4H,1H3,(H2,9,10)
InChI key:InChIKey=OMIHQJBWAPWLBO-UHFFFAOYSA-N
SMILES:NC=1SC=2C(=CC(OC)=CC2)N1
Synonyms:- (5-Methoxybenzothiazol-2-yl)amine
- 2-Amino-5-methoxybenzothiazole
- 2-Benzothiazolamine, 5-methoxy-
- 5-Methoxy-1,3-Benzothiazol-2-Amine
- 5-Methoxy-2-aminobenzothiazole
- 5-Methoxy-2-benzothiazolamine
- 5-Methoxybenzo[d]thiazol-2-amine
- Benzothiazole, 2-amino-5-methoxy-
- Brn 0131022
- 5-Methoxybenzothiazol-2-amine
- 4-27-00-05448 (Beilstein Handbook Reference)
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Amino-5-methoxy-1,3-benzothiazole
CAS:2-Amino-5-methoxy-1,3-benzothiazoleFormula:C8H8N2OSPurity:98%Color and Shape:SolidMolecular weight:180.226925-Methoxybenzo[D]Thiazol-2-Amine
CAS:Formula:C8H8N2OSPurity:96%Color and Shape:SolidMolecular weight:180.22695-Methoxybenzo[d]thiazol-2-amine
CAS:5-Methoxybenzo[d]thiazol-2-amineFormula:C8H8N2OSPurity:97%Molecular weight:180.235-Methoxy-benzothiazol-2-ylamine
CAS:Formula:C8H8N2OSPurity:96%Color and Shape:SolidMolecular weight:180.235-Methoxy-1,3-benzothiazol-2-amine
CAS:5-Methoxy-1,3-benzothiazol-2-amine (5MBZ) is a benzothiazepine with inhibitory activity. It has been shown to bind to the mitochondrial membrane potential in cells and reduce the amount of ATP produced by the mitochondria. 5MBZ also has in vitro cytotoxic activity against cancer cells and has been shown to be effective in reducing β-amyloid production. This compound was synthesized through an imine reaction with 2,4,6-trinitrobenzenesulfonic acid and methylamine. 5MBZ was found to be soluble in water and organic solvents.
Formula:C8H8N2OSPurity:Min. 95%Molecular weight:180.23 g/mol




