CAS 5435-24-5
:diphenylmethyl 4-methylbenzenesulfonate
Description:
Diphenylmethyl 4-methylbenzenesulfonate, with the CAS number 5435-24-5, is an organic compound characterized by its sulfonate ester structure. It features a diphenylmethyl group, which contributes to its stability and hydrophobic properties, and a 4-methylbenzenesulfonate moiety that enhances its reactivity in various chemical reactions. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, making it useful in organic synthesis and as a reagent in chemical reactions. Its sulfonate group imparts polar characteristics, allowing it to participate in nucleophilic substitution reactions. Diphenylmethyl 4-methylbenzenesulfonate is often utilized in the synthesis of more complex organic molecules and can serve as a protecting group for alcohols and amines in synthetic pathways. Safety data indicates that, like many sulfonate esters, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper laboratory safety protocols should be followed when working with this compound.
Formula:C20H18O3S
InChI:InChI=1/C20H18O3S/c1-16-12-14-19(15-13-16)24(21,22)23-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,20H,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OC(c1ccccc1)c1ccccc1
Synonyms:- Benzhydryl 4-methylbenzenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
