CAS 5435-40-5

(2,5-dimethyl-1H-indol-3-yl)acetic acid

Description:

(2,5-Dimethyl-1H-indol-3-yl)acetic acid, with the CAS number 5435-40-5, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features two methyl groups at the 2 and 5 positions of the indole ring, contributing to its unique properties. The presence of the acetic acid functional group at the 3 position of the indole enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological effects, including anti-inflammatory and analgesic properties. The molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the indole ring, which can affect its synthesis and application in various chemical reactions. Overall, (2,5-dimethyl-1H-indol-3-yl)acetic acid represents a significant compound in the realm of organic and medicinal chemistry.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1/C12H13NO2/c1-7-3-4-11-10(5-7)9(6-12(14)15)8(2)13-11/h3-5,13H,6H2,1-2H3,(H,14,15)

SMILES: Cc1ccc2c(c1)c(CC(=O)O)c(C)[nH]2

Synonyms:

• 1H-indole-3-acetic acid, 2,5-dimethyl-

(2,5-Dimethyl-1h-indol-3-yl)acetic acid

CAS: 5435-40-5

Formula: C₁₂H₁₃NO₂

Molecular weight: 203.2371

Ref: IN-DA00DV94

(2,5-Dimethyl-1H-indol-3-yl)acetic acid

CAS: 5435-40-5

(2,5-Dimethyl-1H-indol-3-yl)acetic acid is a fine chemical that is used as a building block in research chemicals and as a reagent in the synthesis of more complex compounds. It has been used as a versatile building block for the synthesis of numerous biologically active compounds and has also been shown to have antiviral activity. This compound is also useful as an intermediate or scaffold in the synthesis of pharmaceuticals. (2,5-Dimethyl-1H-indol-3-yl)acetic acid has CAS number 5435-40-5 and can be found on PubChem CID 6078.

Formula: C₁₂H₁₃NO₂

Purity: Min. 95%

Color and Shape: Red Powder

Molecular weight: 203.24 g/mol

Ref: 3D-FD118293