CAS 5435-41-6

2,7-Dimethyl-1H-indole-3-acetic acid

Description:

2,7-Dimethyl-1H-indole-3-acetic acid, with the CAS number 5435-41-6, is a chemical compound that belongs to the class of indole derivatives. This substance is characterized by its indole structure, which consists of a fused benzene and pyrrole ring, modified by the presence of two methyl groups at the 2 and 7 positions and an acetic acid functional group at the 3 position. The presence of these functional groups contributes to its potential biological activity, particularly in plant growth regulation, as it is related to auxin-like activity. The compound is typically a solid at room temperature and may exhibit solubility in organic solvents. Its molecular structure allows for various interactions, making it of interest in both synthetic organic chemistry and agricultural applications. Additionally, its derivatives may be explored for potential pharmacological properties, although specific biological effects and mechanisms would require further investigation. Overall, 2,7-Dimethyl-1H-indole-3-acetic acid represents a significant compound in the study of plant hormones and organic synthesis.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1S/C12H13NO2/c1-7-4-3-5-9-10(6-11(14)15)8(2)13-12(7)9/h3-5,13H,6H2,1-2H3,(H,14,15)

InChI key: InChIKey=JLNVPHNEFPHGPD-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=2C(NC1C)=C(C)C=CC2

Synonyms:

• 1H-indole-3-acetic acid, 2,7-dimethyl-
• 2,7-Dimethyl-1H-indole-3-acetic acid
• 2-(2,7-Dimethyl-1H-indol-3-yl)acetic acid
• Indole-3-acetic acid, 2,7-dimethyl-
• NSC 21432
• (2,7-Dimethyl-1H-indol-3-yl)acetic acid

(2,7-Dimethyl-1H-indol-3-yl)-acetic acid

CAS: 5435-41-6

Formula: C₁₂H₁₃NO₂

Purity: 95.0%

Molecular weight: 203.241

Ref: 10-F495157