CAS 5436-46-4

Benz[g]indolo[2,3-a]quinolizine, 1,2,3,4-tetrahydro-, mononitrate

Description:

Benz[g]indolo[2,3-a]quinolizine, 1,2,3,4-tetrahydro-, mononitrate, with CAS number 5436-46-4, is a chemical compound that belongs to the class of indole derivatives. This substance features a complex polycyclic structure, which includes a fused indole and quinolizine moiety, contributing to its unique chemical properties. The presence of the tetrahydro group indicates that it has undergone partial hydrogenation, which can influence its reactivity and stability. The mononitrate designation suggests that it contains a nitrate functional group, which may impart explosive or oxidizing characteristics, depending on the context of its use. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and structural complexity. However, specific applications and safety profiles would require further investigation, as the behavior of such compounds can vary significantly based on their environment and formulation. Proper handling and safety measures are essential when working with this substance, given its potential hazards.

Formula: C₁₉H₁₆N₂·HNO₃

InChI: InChI=1S/C19H16N2.HNO3/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1;2-1(3)4/h3-4,7-12H,1-2,5-6H2;(H,2,3,4)

InChI key: InChIKey=IECUCQNAZVURGY-UHFFFAOYSA-N

SMILES: C12=C3N(C=C4C(=C3)CCCC4)C=CC1=C5C(=N2)C=CC=C5.N(=O)(=O)O

Synonyms:

• Benz[g]indolo[2,3-a]quinolizine, 1,2,3,4-tetrahydro-, mononitrate
• NSC 21728

Sempervirine nitrate

CAS: 5436-46-4

Sempervirine nitrate analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₁₉H₁₆N₂HNO₃

Purity: (HPLC) ≥95%

Color and Shape: Powder

Molecular weight: 335.35

Ref: 11-1881S

Sempervirine nitrate

CAS: 5436-46-4

Sempervirine nitrate is a chemical compound, specifically an alkaloid, which is derived from certain plant species traditionally used in ethnomedicine. Its mode of action involves interaction with specific receptor sites within biological systems, influencing cellular pathways through its alkaloidal properties. As a bioactive compound, Sempervirine nitrate is utilized primarily in scientific research to explore its pharmacological effects and potential therapeutic applications.

Formula: C₁₉H₁₆N₂HNO₃

Purity: Min. 95%

Color and Shape: Yellow Powder

Molecular weight: 335.36 g/mol

Ref: 3D-FS65667