CAS 54364-30-6

(4,6-dimethyl-2-thioxopyridin-3(2H)-ylidene)methanediolate

Description:

(4,6-Dimethyl-2-thioxopyridin-3(2H)-ylidene)methanediolate, with the CAS number 54364-30-6, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with two methyl groups and a thioxo group. This compound features a ylidene functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methanediolate moiety indicates that it can exist in a form that is capable of donating protons, making it a potential candidate for various chemical reactions, including those involving nucleophiles. The thioxo group may impart specific electronic properties, influencing the compound's behavior in chemical reactions. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Overall, this substance may have applications in medicinal chemistry, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₈H₇NO₂S

InChI: InChI=1/C8H9NO2S/c1-4-3-5(2)9-7(12)6(4)8(10)11/h3,10-11H,1-2H3/p-2

SMILES: CC1=CC(=NC(=S)C1=C([O-])[O-])C

4,6-Dimethyl-2-sulfanylpyridine-3-carboxylic acid

CAS: 54364-30-6

Versatile small molecule scaffold

Formula: C₈H₉NO₂S

Purity: Min. 95%

Molecular weight: 183.23 g/mol

Ref: 3D-ECA36430