CymitQuimica logo

CAS 543713-09-3

:

tert-butyl {[3-(1-methylethyl)isoxazol-5-yl]methyl}carbamate

Description:
Tert-butyl {[3-(1-methylethyl)isoxazol-5-yl]methyl}carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, an isoxazole ring, and a carbamate functional group. The presence of the isoxazole moiety contributes to its potential biological activity, as isoxazoles are often found in various pharmaceuticals and agrochemicals. The tert-butyl group enhances the compound's lipophilicity, which can influence its solubility and permeability in biological systems. The carbamate functional group is known for its stability and can participate in hydrogen bonding, affecting the compound's reactivity and interaction with other molecules. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its toxicity, efficacy, and mechanism of action would be necessary to fully understand its characteristics and potential uses in various fields.
Formula:C12H20N2O3
InChI:InChI=1/C12H20N2O3/c1-8(2)10-6-9(17-14-10)7-13-11(15)16-12(3,4)5/h6,8H,7H2,1-5H3,(H,13,15)
SMILES:CC(C)c1cc(CN=C(O)OC(C)(C)C)on1
Synonyms:
  • tert-Butyl [(3-isopropyl-1,2-oxazol-5-yl)methyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.