CAS 5438-24-4
:5,6-dimethyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione
Description:
5,6-Dimethyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione, with the CAS number 5438-24-4, is a chemical compound characterized by its unique bicyclic structure that incorporates a benzofuran moiety. This compound features a tetrahydrofuran ring fused to a benzene ring, along with two methyl groups at the 5 and 6 positions, contributing to its overall stability and reactivity. The presence of the diketone functional groups (1,3-dione) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Its structural features suggest potential applications in organic synthesis and medicinal chemistry, particularly in the development of bioactive compounds. The compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and purity. As with many organic compounds, safety precautions should be taken when handling it, as it may exhibit toxicity or irritant properties. Further studies would be necessary to fully elucidate its biological activity and potential uses in various fields.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-5-3-7-8(4-6(5)2)10(12)13-9(7)11/h7-8H,3-4H2,1-2H3
SMILES:CC1=C(C)CC2C(C1)C(=O)OC2=O
Synonyms:- 1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-5,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Dimethyl-3a,4,7,7a-tetrahydro-isobenzofuran-1,3-dione
CAS:Formula:C10H12O3Color and Shape:SolidMolecular weight:180.203
