CAS 54383-28-7
:(6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol
Description:
(6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol, with CAS number 54383-28-7, is a chemical compound characterized by its complex polycyclic structure, which includes a dibenzoquinoline framework. This compound features a methoxy group and a methyl group, contributing to its unique chemical properties and potential biological activity. The presence of the hydroxyl group (–OH) indicates that it may exhibit hydrogen-bonding capabilities, influencing its solubility and reactivity. The stereochemistry, denoted by the (6aS) configuration, suggests specific spatial arrangements that can affect the compound's interaction with biological targets. Such compounds are often studied for their pharmacological properties, including potential roles in medicinal chemistry. The tetrahydro structure implies that it is a saturated derivative, which may enhance its stability compared to unsaturated analogs. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and drug development, although specific applications would depend on further research into its biological activity and interactions.
Formula:C18H19NO2
InChI:InChI=1/C18H19NO2/c1-19-8-7-12-10-15(21-2)18(20)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3/t14-/m0/s1
SMILES:CN1CCc2cc(c(c3c4ccccc4C[C@H]1c23)O)OC
Synonyms:- 4H-Dibenzo(de,g)quinolin-1-ol, 5,6,6a,7-tetrahydro-2-methoxy-6-methyl-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Lirinidine
CAS:(+)-Lirinidine shows antioxidative properties, inhibits melanoma and melanogenesis, and reduces collagen-related platelet aggregation.Formula:C18H19NO2Purity:99.54%Color and Shape:SolidMolecular weight:281.35Lirinidine
CAS:Lirinidine is a synthetic compound, which is derived from laboratory-based chemical synthesis. Its design is rooted in the principles of medicinal chemistry, aiming to interact with specific biochemical pathways. The compound acts as a modulator of neurotransmitter receptors in the central nervous system. Specifically, it targets receptors involved in synaptic transmission, potentially altering neural communication and signaling pathways.Formula:C18H19NO2Purity:Min. 95%Molecular weight:281.3 g/mol




