CAS 5439-13-4

2-bromo-N-(4-bromophenyl)acetamide

Description:

2-bromo-N-(4-bromophenyl)acetamide is an organic compound characterized by its brominated aromatic structure and amide functional group. It features a bromo substituent on the second carbon of the acetamide moiety and a para-bromophenyl group attached to the nitrogen atom of the amide. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic brominated aromatic components. The presence of bromine atoms contributes to its potential biological activity and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit specific properties such as antimicrobial or anticancer activities, which are common in brominated organic compounds. Safety precautions should be taken when handling this substance, as brominated compounds can be hazardous. Proper storage conditions and handling protocols are essential to ensure safety and stability.

Formula: C₈H₇Br₂NO

InChI: InChI=1/C8H7Br2NO/c9-5-8(12)11-7-3-1-6(10)2-4-7/h1-4H,5H2,(H,11,12)

SMILES: c1cc(ccc1Br)NC(=O)CBr

Synonyms:

• acetamide, 2-bromo-N-(4-bromophenyl)-
• Nsc15062
• 2-bromo-N-(4-bromophenyl)ethanamide
• 2-BROMO-N-(4-BROMOPHENYL)ACETAMIDE
• Acetamide, N-(4-bromophenyl)-2-bromo-

2-bromo-N-(4-bromophenyl)acetamide

CAS: 5439-13-4

Formula: C₈H₇Br₂NO

Molecular weight: 292.958

Ref: 10-F368213