CAS 5439-17-8
:2-bromo-N-(3-methylphenyl)acetamide
Description:
2-bromo-N-(3-methylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of a bromine atom at the second position of the carbon chain and a 3-methylphenyl group attached to the nitrogen atom contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic aromatic structure. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the methyl group on the phenyl ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological systems. As with many brominated compounds, it is important to handle 2-bromo-N-(3-methylphenyl)acetamide with care due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C9H10BrNO
InChI:InChI=1/C9H10BrNO/c1-7-3-2-4-8(5-7)11-9(12)6-10/h2-5H,6H2,1H3,(H,11,12)
SMILES:Cc1cccc(c1)N=C(CBr)O
Synonyms:- acetamide, 2-bromo-N-(3-methylphenyl)-
- CHEMBRDG-BB 4023662
- 2-bromo-N-(3-methylphenyl)acetamide(SALTDATA: FREE)
- 2-bromo-N-(3-methylphenyl)ethanamide
- AKOS BBB/457
- 2-BroMo-5-Methylacetanilide
- AKOS BB/0105
- Acetamide, N-(3-methylphenyl)-2-bromo-
- 2-BROMO-N-(3-METHYLPHENYL)ACETAMIDE
- 2-BROMO-N-M-TOLYL-ACETAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromo-N-(3-methylphenyl)acetamide
CAS:Controlled ProductFormula:C9H10BrNOColor and Shape:NeatMolecular weight:228.086

