CAS 5439-87-2
:3-[(carboxymethyl)sulfinyl]alanine
Description:
3-[(Carboxymethyl)sulfinyl]alanine, with the CAS number 5439-87-2, is an amino acid derivative characterized by the presence of a sulfinyl group and a carboxymethyl substituent on the alanine backbone. This compound features a sulfur atom bonded to an oxygen atom, indicating its sulfinyl nature, which contributes to its unique chemical reactivity and potential biological activity. The carboxymethyl group enhances its solubility in water and may influence its interaction with biological systems, making it of interest in biochemical research. As an amino acid derivative, it retains the basic structure of amino acids, including an amino group, a carboxylic acid group, and a side chain that distinguishes it from other amino acids. The presence of both the sulfinyl and carboxymethyl groups suggests potential applications in pharmaceuticals, particularly in the development of compounds that can modulate biological pathways or serve as intermediates in synthetic chemistry. Its stability, solubility, and reactivity make it a valuable compound for further study in various chemical and biological contexts.
Formula:C23H37NO7S2
InChI:InChI=1/C18H28O3S.C5H9NO4S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;6-3(5(9)10)1-11-2-4(7)8/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1
SMILES:CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.C([C@@H](C(=O)O)N)SCC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(2R)-2-Amino-3-((carboxymethyl)sulfinyl)propanoic acid
CAS:(2R)-2-Amino-3-((carboxymethyl)sulfinyl)propanoic acidPurity:97%Molecular weight:195.2g/molS-Carboxymethyl-L-Cysteine Sulfoxide (Carbocisteine S-Oxide)
CAS:Formula:C5H9NO5SColor and Shape:White To Off-White SolidMolecular weight:195.19(S)-Carboxymethyl-L-cysteine (R/S)-Sulphoxide
CAS:Controlled ProductFormula:C5H9NO5SColor and Shape:NeatMolecular weight:195.19Carbocisteine Sulfoxide(Mixture of diastereomers)
CAS:Applications Carbocisteine Sulfoxide is an impurity of the mucolytic agent Carbocisteine (C178760).
References Synge, R., et al.: Biochem. J., 64, 252 (1956); Waring, R., et al.: Drug Metab. Dispos., 10, 61 (1982); Mitchell, S., et al.: Xenobiotica, 14, 767 (1984);Formula:C5H9NO5SColor and Shape:WhiteMolecular weight:195.19Carbocysteine sulfoxide
CAS:Please enquire for more information about Carbocysteine sulfoxide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H9NO5SPurity:Min. 95%Molecular weight:195.19 g/mol





