CAS 544-44-5
:8-Hydroxy-2,4,6-octatriynamide
Description:
8-Hydroxy-2,4,6-octatriynamide, with the CAS number 544-44-5, is a chemical compound characterized by its unique structure that includes a hydroxyl group and multiple triple bonds within its carbon chain. This compound belongs to the class of amides, which are derivatives of carboxylic acids where the hydroxyl group is replaced by an amine or ammonia. The presence of the hydroxyl group imparts some polar characteristics, potentially affecting its solubility in various solvents. The multiple triple bonds contribute to its reactivity and may influence its physical properties, such as melting and boiling points. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, which can be relevant in applications such as organic electronics or materials science. However, specific details regarding its stability, reactivity, and potential applications would require further investigation, as they can vary based on environmental conditions and the presence of other chemical species.
Formula:C8H5NO2
InChI:InChI=1/C8H5NO2/c9-8(11)6-4-2-1-3-5-7-10/h10H,7H2,(H2,9,11)
InChI key:InChIKey=OXONWCQUZYDTNF-UHFFFAOYSA-N
SMILES:C(#CC#CCO)C#CC(N)=O
Synonyms:- Agrocybin
- 2,4,6-Octatriynamide, 8-hydroxy-
- NSC 636326
- 544-44-5
- 8-Hydroxy-2,4,6-octatriynamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Agrocybin
CAS:<p>Agrocybin is an antifungal peptide that exhibits activity against various fungi but lacks inhibitory effects on bacteria. It also attenuates the activity of HIV-1 reverse transcriptase (HIV-1 reverse transcriptase).</p>Formula:C8H5NO2Color and Shape:SolidMolecular weight:147.131
