CAS 544-51-4

(3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid

Description:

(3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid, with the CAS number 544-51-4, is a polyunsaturated fatty acid characterized by its long carbon chain and multiple double and triple bonds. This compound features a conjugated system of double bonds, which contributes to its unique chemical properties, including increased reactivity and potential biological activity. The presence of both alkene and alkyne functional groups allows for various chemical transformations, making it a subject of interest in organic synthesis and biochemistry. Its structure includes a carboxylic acid functional group, which imparts acidic properties and enhances its solubility in polar solvents. The geometric configuration of the double bonds (E and Z isomers) plays a crucial role in determining its physical and chemical behavior. This compound may be involved in various biological processes, including signaling pathways and membrane dynamics, due to its structural characteristics. Overall, (3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid is a significant compound in the study of unsaturated fatty acids and their derivatives.

Formula: C₁₃H₁₀O₂

InChI: InChI=1/C13H10O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h1,5,7-11H,12H2,(H,14,15)/b9-8-,11-10+

InChI key: InChIKey=APNPVBXEWGCCLU-QNRZBPGKSA-N

SMILES: C(\C=C/C=C=CC#CC#C)=C/CC(O)=O

Synonyms:

• (3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid
• 3,5,7,8-Tridecatetraene-10,12-diynoic acid, (3E,5Z)-
• 3,5,7,8-Tridecatetraene-10,12-diynoic acid, (Z,E)-
• Mycomycin
• Antiblastin

Antiblastin

CAS: 544-51-4

Antiblastin is an antifungal antibiotic identified in cultures of Bacillus chrysomyxa.

Formula: C₁₃H₁₀O₂

Color and Shape: Solid

Molecular weight: 198.217

Ref: TM-TN9110