CAS 5440-00-6
:5,6-Diamino-1,3-dimethyluracil
Description:
5,6-Diamino-1,3-dimethyluracil, with the CAS number 5440-00-6, is a synthetic organic compound that belongs to the class of pyrimidine derivatives. It features two amino groups at the 5 and 6 positions and two methyl groups at the 1 and 3 positions of the uracil ring. This compound is characterized by its potential biological activity, particularly in relation to its role as a nucleobase analog, which can influence nucleic acid metabolism. It is often studied for its potential applications in medicinal chemistry, especially in the development of antiviral and anticancer agents. The presence of amino and methyl groups contributes to its solubility and reactivity, making it a subject of interest in various chemical and biological research fields. Additionally, its structural similarity to natural nucleobases allows it to interact with biological systems, potentially affecting processes such as DNA and RNA synthesis. Safety and handling precautions are essential when working with this compound, as with many chemical substances.
Formula:C6H10N4O2
InChI:InChI=1S/C6H10N4O2/c1-9-4(8)3(7)5(11)10(2)6(9)12/h7-8H2,1-2H3
InChI key:InChIKey=BGQNOPFTJROKJE-UHFFFAOYSA-N
SMILES:NC1=C(N)N(C)C(=O)N(C)C1=O
Synonyms:- 1,3-Dimethyl-5,6-diaminouracil
- 2,4(1H,3H)-Pyrimidinedione, 5,6-diamino-1,3-dimethyl-
- 4,5-Diamino-1,3-dimethyl-2,6-dioxotetrahydropyrimidine
- 4,5-Diamino-1,3-dimethylpyrimidine-2,6-dione
- 4,5-Diamino-1,3-dimethyluracil
- 5,6-Diamino-1,3-Dimethyl Uracil
- 5,6-Diamino-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
- 5,6-Diamino-1,3-dimethyl-2,4-pyrimidinedione
- 5,6-Diamino-1,3-dimethyluracil
- 5,6-diamino-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
- NSC 15493
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5,6-Diamino-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
CAS:Formula:C6H10N4O2Purity:98%Color and Shape:SolidMolecular weight:170.16925,6-Diamino-1,3-dimethyl uracil
CAS:5,6-Diamino-1,3-dimethyl uracilPurity:97%Color and Shape:SolidMolecular weight:170.17g/mol5,6-Diamino-1,3-dimethyl uracil hydrate
CAS:5,6-Diamino-1,3-dimethyl uracil hydrate is a purine derivative that inhibits the growth of cancer cells by blocking the enzyme ribonucleotide reductase. This leads to a decrease in DNA synthesis, protein synthesis, and cell division. The anticancer activity of 5,6-Diamino-1,3-dimethyl uracil hydrate is due to its ability to inhibit the formation of ATP and the GTP cycle. It also has a potent inhibitory effect on the structural analysis of DNA and RNA. 5,6-Diamino-1,3-dimethyl uracil hydrate has been shown to produce apoptotic effects in many types of cancer cells. This drug also has specific agonist properties for G protein coupled receptors that are responsible for activating apoptosis.Formula:C6H10N4O2·xH2OPurity:Min. 95%Color and Shape:PowderMolecular weight:170.17 g/mol5,6-Diamino-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
CAS:Formula:C6H10N4O2Purity:95.0%Color and Shape:SolidMolecular weight:170.172






