CAS 54404-06-7
:3-oxo-2,3-dihydropyridazine-4-carboxylic acid
Description:
3-Oxo-2,3-dihydropyridazine-4-carboxylic acid, with the CAS number 54404-06-7, is a heterocyclic compound characterized by its pyridazine ring structure, which includes a ketone and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The presence of the keto group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and substitution reactions. Its structure suggests that it may participate in biological activities, possibly serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's unique features, including its ability to form hydrogen bonds due to the carboxylic acid, may influence its interactions in biological systems or materials science applications. Overall, 3-oxo-2,3-dihydropyridazine-4-carboxylic acid is of interest for its potential applications in organic synthesis and medicinal chemistry.
Formula:C5H4N2O3
InChI:InChI=1/C5H4N2O3/c8-4-3(5(9)10)1-2-6-7-4/h1-2H,(H,7,8)(H,9,10)
SMILES:c1cnnc(c1C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Oxo-2,3-dihydropyridazine-4-carboxylic acid
CAS:Formula:C5H4N2O3Purity:97%Color and Shape:SolidMolecular weight:140.09693-Oxo-2,3-dihydropyridazine-4-carboxylic acid
CAS:3-Oxo-2,3-dihydropyridazine-4-carboxylic acidPurity:98%Molecular weight:140.1g/mol3-Oxo-2,3-dihydropyridazine-4-carboxylic acid
CAS:Formula:C5H4N2O3Purity:98%Color and Shape:Off-white powderMolecular weight:140.0983-Oxo-2,3-dihydropyridazine-4-carboxylic acid
CAS:3-Oxo-2,3-dihydropyridazine-4-carboxylic acid (3ODPCA) is a molecule that is used to treat endometriosis. It has been shown to have anti-inflammatory properties, which may be due to its ability to inhibit the production of prostaglandin E2 and nitric oxide. 3ODPCA binds to DNA with high affinity and interferes with transcription by inhibiting the binding of RNA polymerase II and III, preventing the synthesis of mRNA. This drug also inhibits protein synthesis in cells by inhibiting ribosome translocation on mRNA. 3ODPCA has been shown to be an effective treatment for endometriosis in rats and mice models.Formula:C5H4N2O3Purity:Min. 95%Molecular weight:140.1 g/mol



