CAS 54408-35-4

1-(3-phenylisoxazol-5-yl)methanamine

Description:

1-(3-phenylisoxazol-5-yl)methanamine, with the CAS number 54408-35-4, is an organic compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a phenyl group attached to the isoxazole, contributing to its aromatic properties. The methanamine functional group indicates the presence of an amine, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of both the isoxazole and amine functionalities suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various biological pathways. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by factors such as pH and solvent polarity, which are important considerations in both synthetic and analytical chemistry contexts.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h1-6H,7,11H2

SMILES: c1ccc(cc1)c1cc(CN)on1

Synonyms:

• 1-(3-Phenyl-1,2-Oxazol-5-Yl)Methanamine
• 5-Isoxazolemethanamine, 3-Phenyl-
• (3-Phenyl-5-Isoxazolyl)Methanamine

(3-PHENYL-5-ISOXAZOLYL)METHANAMINE

CAS: 54408-35-4

Formula: C₁₀H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.1992

Ref: IN-DA00D8BZ

5-(Aminomethyl)-3-phenylisoxazole

CAS: 54408-35-4

5-(Aminomethyl)-3-phenylisoxazole

Purity: 95%

Color and Shape: Yellow Solid

Molecular weight: 174.20g/mol

Ref: 54-OR15367

1-(3-phenylisoxazol-5-yl)methanamine

CAS: 54408-35-4

Formula: C₁₀H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F313566