
CAS 54413-93-3
:2-Iodo-5-methoxybenzoic acid
Description:
2-Iodo-5-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a methoxy group on a benzene ring. Its molecular structure features a benzoic acid core, with the iodine substituent located at the second position and the methoxy group at the fifth position relative to the carboxylic acid functional group. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of the iodine atom can impart unique reactivity, making it useful in various organic synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. The methoxy group can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. As with many halogenated compounds, appropriate safety measures should be taken when handling 2-Iodo-5-methoxybenzoic acid, as it may pose health and environmental risks.
Formula:C8H7IO3
InChI:InChI=1S/C8H7IO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:DASWULXFGZZRIC-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)I)C(=O)O
Synonyms:- 5-Methoxy-2-iodobenzoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Iodo-5-Methoxybenzoic Acid
CAS:Formula:C8H7IO3Purity:95%Color and Shape:SolidMolecular weight:278.04392-Iodo-5-methoxybenzoic acid
CAS:2-Iodo-5-methoxybenzoic acidFormula:C8H7IO3Purity:99%Color and Shape:SolidMolecular weight:278.0452-Iodo-5-methoxybenzoic acid
CAS:Formula:C8H7IO3Purity:95%Color and Shape:SolidMolecular weight:278.0452-Iodo-5-methoxybenzoic acid
CAS:2-Iodo-5-methoxybenzoic acidFormula:C8H7IO3Purity:97%Molecular weight:278.042-Iodo-5-methoxybenzoic acid
CAS:2-Iodo-5-methoxybenzoic acid is a macrocyclic compound that has been synthesized in the Wittig reaction. It was first prepared by catalyzed intramolecular aryl demethylation of 2-iodo-5-nitrobenzoic acid, followed by coupling with methyl vinyl ketone. The cytotoxic activity of this compound is due to its ability to inhibit the synthesis of protein and DNA and induce apoptosis. This molecule has been shown to be effective against liverworts and ethers.
Formula:C8H7IO3Purity:Min. 95%Color and Shape:PowderMolecular weight:278.04 g/mol




