CAS 54415-77-9

4-HYDROXY-5-AZAINDOLE

Description:

4-Hydroxy-5-azaindole is a heterocyclic organic compound characterized by its fused indole structure, which incorporates a nitrogen atom in place of a carbon in the pyrrole ring. This substitution contributes to its unique chemical properties, including its ability to participate in hydrogen bonding due to the presence of the hydroxyl (-OH) group. The compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents, which can be attributed to its functional groups. It is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anticancer properties. The presence of the hydroxyl group enhances its reactivity, making it a candidate for further chemical modifications. Additionally, 4-hydroxy-5-azaindole can serve as a building block in the synthesis of more complex molecules. Its stability and reactivity can be influenced by factors such as pH and the presence of other chemical species in the environment. Overall, this compound represents a significant area of study for researchers exploring novel therapeutic agents.

Formula: C₇H₆N₂O

InChI: InChI:1S/C7H6N2O/c10-7-5-1-3-8-6(5)2-4-9-7/h1-4,8H,(H,9,10)

1,5-dihydro-4h-pyrrolo[3,2-c]pyridin-4-one

CAS: 54415-77-9

Formula: C₇H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA003799

1H-Pyrrolo[3,2-c]pyridin-4(5H)-one

CAS: 54415-77-9

1H-Pyrrolo[3,2-c]pyridin-4(5H)-one

Purity: 98%

Molecular weight: 134.14g/mol

Ref: 54-OR1059912

1H-Pyrrolo[3,2-c]pyridin-4(5H)-one

CAS: 54415-77-9

The compound 1H-Pyrrolo[3,2-c]pyridin-4(5H)-one is an enantiomer that is used as a starting material for the synthesis of other drugs. The hydrochloride salt is used in the manufacture of pharmaceuticals. This drug has been shown to be a potent inhibitor of xanthine oxidase and may have potential use in the treatment of gout and hyperuricemia.

Formula: C₇H₆N₂O

Purity: Min. 95%

Molecular weight: 134.14 g/mol

Ref: 3D-FP140758

1H-Pyrrolo[3,2-c]pyridin-4(5H)-one

CAS: 54415-77-9

Formula: C₇H₆N₂O

Purity: 98%

Molecular weight: 134.138

Ref: 10-F225138