CAS 54415-85-9

1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one

Description:

1,3-Dihydro-2H-pyrrolo[2,3-c]pyridin-2-one, with the CAS number 54415-85-9, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a bicyclic structure that contributes to its unique chemical properties. It typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the carbonyl group in the lactam form enhances its reactivity and potential for forming hydrogen bonds, which can influence its interactions with biological targets. Additionally, the compound may exhibit moderate solubility in polar solvents, which is common for many nitrogen-containing heterocycles. Its structural features may also allow for various substitution patterns, leading to derivatives with potentially enhanced pharmacological properties. Overall, 1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c10-7-3-5-1-2-8-4-6(5)9-7/h1-2,4H,3H2,(H,9,10)

SMILES: c1cncc2c1CC(=N2)O

Synonyms:

• 1,3-Dihydropyrrolo[2,3-c]pyridin-2-one hydrochloride

1H-Pyrrolo[2,3-c]pyridin-2(3H)-one

CAS: 54415-85-9

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA00DBTN

1H,3H-Pyrrolo[2,3-c]pyridin-2-one hydrochloride

CAS: 54415-85-9

1H,3H-Pyrrolo[2,3-c]pyridin-2-one hydrochloride

Molecular weight: 134.13534g/mol

Ref: 54-OR1021009

1H-Pyrrolo[2,3-c]pyridin-2(3H)-one

CAS: 54415-85-9

1H-Pyrrolo[2,3-c]pyridin-2(3H)-one (1) is a synthetic compound that has been extracted from coal tar. It is the product of nitro reduction and transfer hydrogenation. 1H-Pyrrolo[2,3-c]pyridin-2(3H)-one is an unactivated heteroaromatic base with a phenyl ring and a pyridine ring. This compound has been used in experimental studies as a biomolecular research tool and medicinally as an oxindole. The synthesis of this compound requires two cyclization steps, one of which can be achieved by hydrogenation.

Formula: C₇H₆N₂O

Purity: Min. 95%

Molecular weight: 134.14 g/mol

Ref: 3D-ECA41585