CAS 5442-51-3
:2-[(6-chloro-2-methoxyacridin-9-yl)sulfanyl]butanedioic acid
Description:
2-[(6-Chloro-2-methoxyacridin-9-yl)sulfanyl]butanedioic acid, with the CAS number 5442-51-3, is a chemical compound that features a butanedioic acid backbone substituted with a sulfanyl group linked to a chloro-methoxyacridine moiety. This compound exhibits characteristics typical of both organic acids and heterocyclic compounds. The presence of the butanedioic acid component suggests it has acidic properties, likely capable of donating protons in solution. The acridine structure contributes to its potential biological activity, as acridines are known for their roles in pharmaceuticals and as intercalating agents in DNA. The chloro and methoxy substituents can influence the compound's solubility, reactivity, and overall biological interactions. Additionally, the sulfanyl group may enhance its reactivity and potential for forming disulfide bonds. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.
Formula:C18H14ClNO5S
InChI:InChI=1/C18H14ClNO5S/c1-25-10-3-5-13-12(7-10)17(26-15(18(23)24)8-16(21)22)11-4-2-9(19)6-14(11)20-13/h2-7,15H,8H2,1H3,(H,21,22)(H,23,24)
Synonyms:- 2-(6-chloro-2-methoxy-acridin-9-yl)sulfanylbutanedioic acid
- Butanedioic acid, 2-[(6-chloro-2-methoxy-9-acridinyl)thio]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
